C14H20N6S — CID 79932781
[2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-ylmethyl)thieno[2,3-d]pyrimidin-4-yl]hydrazine (PubChem CID 79932781) has the molecular formula C14H20N6S and a molecular weight of 304.42 g/mol. Its IUPAC name is [2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-ylmethyl)thieno[2,3-d]pyrimidin-4-yl]hydrazine.
| Compound Name | [2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-ylmethyl)thieno[2,3-d]pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 79932781 |
| Molecular Formula | C14H20N6S |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | [2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-ylmethyl)thieno[2,3-d]pyrimidin-4-yl]hydrazine |
| SMILES | NNc1nc(CN2CCN3CCCC3C2)nc2sccc12 |
| InChI | InChI=1S/C14H20N6S/c15-18-13-11-3-7-21-14(11)17-12(16-13)9-19-5-6-20-4-1-2-10(20)8-19/h3,7,10H,1-2,4-6,8-9,15H2,(H,16,17,18) |
| InChIKey | POVORTVKRMOMRY-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|