C14H19N3O2S — CID 79932973
3-methyl-2-[(4-methyl-1,3-thiazol-2-yl)methyl]-3,6,7,8,9,9a-hexahydropyrido[1,2-a]pyrazine-1,4-dione (PubChem CID 79932973) has the molecular formula C14H19N3O2S and a molecular weight of 293.39 g/mol. Its IUPAC name is 3-methyl-2-[(4-methyl-1,3-thiazol-2-yl)methyl]-3,6,7,8,9,9a-hexahydropyrido[1,2-a]pyrazine-1,4-dione.
| Compound Name | 3-methyl-2-[(4-methyl-1,3-thiazol-2-yl)methyl]-3,6,7,8,9,9a-hexahydropyrido[1,2-a]pyrazine-1,4-dione |
|---|---|
| PubChem CID | 79932973 |
| Molecular Formula | C14H19N3O2S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 3-methyl-2-[(4-methyl-1,3-thiazol-2-yl)methyl]-3,6,7,8,9,9a-hexahydropyrido[1,2-a]pyrazine-1,4-dione |
| SMILES | Cc1csc(CN2C(=O)C3CCCCN3C(=O)C2C)n1 |
| InChI | InChI=1S/C14H19N3O2S/c1-9-8-20-12(15-9)7-17-10(2)13(18)16-6-4-3-5-11(16)14(17)19/h8,10-11H,3-7H2,1-2H3 |
| InChIKey | HXNXIDBYOUTDJK-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |