C15H30N4O — CID 79934992
2-amino-2-methyl-5-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)pentanamide (PubChem CID 79934992) has the molecular formula C15H30N4O and a molecular weight of 282.43 g/mol. Its IUPAC name is 2-amino-2-methyl-5-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)pentanamide.
| Compound Name | 2-amino-2-methyl-5-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)pentanamide |
|---|---|
| PubChem CID | 79934992 |
| Molecular Formula | C15H30N4O |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.24 |
| IUPAC Name | 2-amino-2-methyl-5-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)pentanamide |
| SMILES | CC1CN2CCCCC2CN1CCCC(C)(N)C(N)=O |
| InChI | InChI=1S/C15H30N4O/c1-12-10-19-8-4-3-6-13(19)11-18(12)9-5-7-15(2,17)14(16)20/h12-13H,3-11,17H2,1-2H3,(H2,16,20) |
| InChIKey | TZFCLTLQTQCKDN-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 75.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |