C13H25BrN2 — CID 79935696
2-[2-(bromomethyl)butyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine (PubChem CID 79935696) has the molecular formula C13H25BrN2 and a molecular weight of 289.26 g/mol. Its IUPAC name is 2-[2-(bromomethyl)butyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine.
| Compound Name | 2-[2-(bromomethyl)butyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine |
|---|---|
| PubChem CID | 79935696 |
| Molecular Formula | C13H25BrN2 |
| Molecular Weight | 289.26 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 2-[2-(bromomethyl)butyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine |
| SMILES | CCC(CBr)CN1CCN2CCCCC2C1 |
| InChI | InChI=1S/C13H25BrN2/c1-2-12(9-14)10-15-7-8-16-6-4-3-5-13(16)11-15/h12-13H,2-11H2,1H3 |
| InChIKey | HIAYTEVGCARXPI-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.26 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|