C13H23N5O2S — CID 79936069
2-[4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-ylsulfonyl)pyrazol-1-yl]-N-methylethanamine (PubChem CID 79936069) has the molecular formula C13H23N5O2S and a molecular weight of 313.43 g/mol. Its IUPAC name is 2-[4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-ylsulfonyl)pyrazol-1-yl]-N-methylethanamine.
| Compound Name | 2-[4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-ylsulfonyl)pyrazol-1-yl]-N-methylethanamine |
|---|---|
| PubChem CID | 79936069 |
| Molecular Formula | C13H23N5O2S |
| Molecular Weight | 313.43 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | 2-[4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-ylsulfonyl)pyrazol-1-yl]-N-methylethanamine |
| SMILES | CNCCn1cc(S(=O)(=O)N2CCN3CCCC3C2)cn1 |
| InChI | InChI=1S/C13H23N5O2S/c1-14-4-6-17-11-13(9-15-17)21(19,20)18-8-7-16-5-2-3-12(16)10-18/h9,11-12,14H,2-8,10H2,1H3 |
| InChIKey | QSAPZWMEMLBIJH-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.43 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |