C13H18N4O4 — CID 79937009
5-[(2,5-dioxo-4-propylpiperazin-1-yl)methyl]furan-2-carbohydrazide (PubChem CID 79937009) has the molecular formula C13H18N4O4 and a molecular weight of 294.31 g/mol. Its IUPAC name is 5-[(2,5-dioxo-4-propylpiperazin-1-yl)methyl]furan-2-carbohydrazide.
| Compound Name | 5-[(2,5-dioxo-4-propylpiperazin-1-yl)methyl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 79937009 |
| Molecular Formula | C13H18N4O4 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 5-[(2,5-dioxo-4-propylpiperazin-1-yl)methyl]furan-2-carbohydrazide |
| SMILES | CCCN1CC(=O)N(Cc2ccc(C(=O)NN)o2)CC1=O |
| InChI | InChI=1S/C13H18N4O4/c1-2-5-16-7-12(19)17(8-11(16)18)6-9-3-4-10(21-9)13(20)15-14/h3-4H,2,5-8,14H2,1H3,(H,15,20) |
| InChIKey | MGOJTAIYFGHQSA-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 108.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|