About 5-[(2,5-dioxo-4-propylpiperazin-1-yl)methyl]furan-2-carbohydrazide
5-[(2,5-dioxo-4-propylpiperazin-1-yl)methyl]furan-2-carbohydrazide (PubChem CID 79937009) has the molecular formula C13H18N4O4
and a molecular weight of 294.31 g/mol. Its IUPAC name is 5-[(2,5-dioxo-4-propylpiperazin-1-yl)methyl]furan-2-carbohydrazide.
Molecular Properties
| Compound Name | 5-[(2,5-dioxo-4-propylpiperazin-1-yl)methyl]furan-2-carbohydrazide |
| PubChem CID | 79937009 |
| Molecular Formula | C13H18N4O4 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 5-[(2,5-dioxo-4-propylpiperazin-1-yl)methyl]furan-2-carbohydrazide |
| SMILES | CCCN1CC(=O)N(Cc2ccc(C(=O)NN)o2)CC1=O |
| InChI | InChI=1S/C13H18N4O4/c1-2-5-16-7-12(19)17(8-11(16)18)6-9-3-4-10(21-9)13(20)15-14/h3-4H,2,5-8,14H2,1H3,(H,15,20) |
| InChIKey | MGOJTAIYFGHQSA-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 108.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-[(2,5-dioxo-4-propylpiperazin-1-yl)methyl]furan-2-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2,5-dioxo-4-propylpiperazin-1-yl)methyl]furan-2-carbohydrazide?
The IUPAC name of 5-[(2,5-dioxo-4-propylpiperazin-1-yl)methyl]furan-2-carbohydrazide (CID 79937009) is 5-[(2,5-dioxo-4-propylpiperazin-1-yl)methyl]furan-2-carbohydrazide.
What is the SMILES notation for 5-[(2,5-dioxo-4-propylpiperazin-1-yl)methyl]furan-2-carbohydrazide?
The canonical SMILES for 5-[(2,5-dioxo-4-propylpiperazin-1-yl)methyl]furan-2-carbohydrazide is CCCN1CC(=O)N(Cc2ccc(C(=O)NN)o2)CC1=O.
What is the InChIKey of 5-[(2,5-dioxo-4-propylpiperazin-1-yl)methyl]furan-2-carbohydrazide?
The InChIKey is MGOJTAIYFGHQSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N4O4/c1-2-5-16-7-12(19)17(8-11(16)18)6-9-3-4-10(21-9)13(20)15-14/h3-4H,2,5-8,14H2,1H3,(H,15,20).
What are the key properties of 5-[(2,5-dioxo-4-propylpiperazin-1-yl)methyl]furan-2-carbohydrazide?
5-[(2,5-dioxo-4-propylpiperazin-1-yl)methyl]furan-2-carbohydrazide has a molecular weight of 294.31 g/mol, XLogP of -0.54, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2,5-dioxo-4-propylpiperazin-1-yl)methyl]furan-2-carbohydrazide is sourced from PubChem (CID 79937009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).