About 2-methyl-3-(4-methyl-2,5-dioxopiperazin-1-yl)propanethioamide
2-methyl-3-(4-methyl-2,5-dioxopiperazin-1-yl)propanethioamide (PubChem CID 79937126) has the molecular formula C9H15N3O2S
and a molecular weight of 229.30 g/mol. Its IUPAC name is 2-methyl-3-(4-methyl-2,5-dioxopiperazin-1-yl)propanethioamide.
Molecular Properties
| Compound Name | 2-methyl-3-(4-methyl-2,5-dioxopiperazin-1-yl)propanethioamide |
| PubChem CID | 79937126 |
| Molecular Formula | C9H15N3O2S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 2-methyl-3-(4-methyl-2,5-dioxopiperazin-1-yl)propanethioamide |
| SMILES | CC(CN1CC(=O)N(C)CC1=O)C(N)=S |
| InChI | InChI=1S/C9H15N3O2S/c1-6(9(10)15)3-12-5-7(13)11(2)4-8(12)14/h6H,3-5H2,1-2H3,(H2,10,15) |
| InChIKey | DAFVNJNHZSVEMB-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-3-(4-methyl-2,5-dioxopiperazin-1-yl)propanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3-(4-methyl-2,5-dioxopiperazin-1-yl)propanethioamide?
The IUPAC name of 2-methyl-3-(4-methyl-2,5-dioxopiperazin-1-yl)propanethioamide (CID 79937126) is 2-methyl-3-(4-methyl-2,5-dioxopiperazin-1-yl)propanethioamide.
What is the SMILES notation for 2-methyl-3-(4-methyl-2,5-dioxopiperazin-1-yl)propanethioamide?
The canonical SMILES for 2-methyl-3-(4-methyl-2,5-dioxopiperazin-1-yl)propanethioamide is CC(CN1CC(=O)N(C)CC1=O)C(N)=S.
What is the InChIKey of 2-methyl-3-(4-methyl-2,5-dioxopiperazin-1-yl)propanethioamide?
The InChIKey is DAFVNJNHZSVEMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O2S/c1-6(9(10)15)3-12-5-7(13)11(2)4-8(12)14/h6H,3-5H2,1-2H3,(H2,10,15).
What are the key properties of 2-methyl-3-(4-methyl-2,5-dioxopiperazin-1-yl)propanethioamide?
2-methyl-3-(4-methyl-2,5-dioxopiperazin-1-yl)propanethioamide has a molecular weight of 229.30 g/mol, XLogP of -0.79, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3-(4-methyl-2,5-dioxopiperazin-1-yl)propanethioamide is sourced from PubChem (CID 79937126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).