C11H18N4O3S — CID 79937245
[5-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-ylsulfonyl)-1H-pyrazol-4-yl]methanol (PubChem CID 79937245) has the molecular formula C11H18N4O3S and a molecular weight of 286.36 g/mol. Its IUPAC name is [5-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-ylsulfonyl)-1H-pyrazol-4-yl]methanol.
| Compound Name | [5-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-ylsulfonyl)-1H-pyrazol-4-yl]methanol |
|---|---|
| PubChem CID | 79937245 |
| Molecular Formula | C11H18N4O3S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | [5-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-ylsulfonyl)-1H-pyrazol-4-yl]methanol |
| SMILES | O=S(=O)(c1[nH]ncc1CO)N1CCN2CCCC2C1 |
| InChI | InChI=1S/C11H18N4O3S/c16-8-9-6-12-13-11(9)19(17,18)15-5-4-14-3-1-2-10(14)7-15/h6,10,16H,1-5,7-8H2,(H,12,13) |
| InChIKey | AGMIHAJSVPLUOH-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 89.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |