About [(2S)-1-amino-1-oxopropan-2-yl] 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-hydroxy-3-methylbenzoate
[(2S)-1-amino-1-oxopropan-2-yl] 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-hydroxy-3-methylbenzoate (PubChem CID 7993739) has the molecular formula C20H18N2O6
and a molecular weight of 382.37 g/mol. Its IUPAC name is [(2S)-1-amino-1-oxopropan-2-yl] 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-hydroxy-3-methylbenzoate.
Molecular Properties
| Compound Name | [(2S)-1-amino-1-oxopropan-2-yl] 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-hydroxy-3-methylbenzoate |
| PubChem CID | 7993739 |
| Molecular Formula | C20H18N2O6 |
| Molecular Weight | 382.37 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | [(2S)-1-amino-1-oxopropan-2-yl] 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-hydroxy-3-methylbenzoate |
| SMILES | Cc1cc(CN2C(=O)c3ccccc3C2=O)cc(C(=O)O[C@@H](C)C(N)=O)c1O |
| InChI | InChI=1S/C20H18N2O6/c1-10-7-12(8-15(16(10)23)20(27)28-11(2)17(21)24)9-22-18(25)13-5-3-4-6-14(13)19(22)26/h3-8,11,23H,9H2,1-2H3,(H2,21,24)/t11-/m0/s1 |
| InChIKey | YMOLJJAJURXICV-NSHDSACASA-N |
| XLogP | 1.53 |
| TPSA | 127.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.37 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-1-amino-1-oxopropan-2-yl] 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-hydroxy-3-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-1-amino-1-oxopropan-2-yl] 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-hydroxy-3-methylbenzoate?
The IUPAC name of [(2S)-1-amino-1-oxopropan-2-yl] 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-hydroxy-3-methylbenzoate (CID 7993739) is [(2S)-1-amino-1-oxopropan-2-yl] 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-hydroxy-3-methylbenzoate.
What is the SMILES notation for [(2S)-1-amino-1-oxopropan-2-yl] 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-hydroxy-3-methylbenzoate?
The canonical SMILES for [(2S)-1-amino-1-oxopropan-2-yl] 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-hydroxy-3-methylbenzoate is Cc1cc(CN2C(=O)c3ccccc3C2=O)cc(C(=O)O[C@@H](C)C(N)=O)c1O.
What is the InChIKey of [(2S)-1-amino-1-oxopropan-2-yl] 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-hydroxy-3-methylbenzoate?
The InChIKey is YMOLJJAJURXICV-NSHDSACASA-N. The full InChI is InChI=1S/C20H18N2O6/c1-10-7-12(8-15(16(10)23)20(27)28-11(2)17(21)24)9-22-18(25)13-5-3-4-6-14(13)19(22)26/h3-8,11,23H,9H2,1-2H3,(H2,21,24)/t11-/m0/s1.
What are the key properties of [(2S)-1-amino-1-oxopropan-2-yl] 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-hydroxy-3-methylbenzoate?
[(2S)-1-amino-1-oxopropan-2-yl] 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-hydroxy-3-methylbenzoate has a molecular weight of 382.37 g/mol, XLogP of 1.53, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-1-amino-1-oxopropan-2-yl] 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-hydroxy-3-methylbenzoate is sourced from PubChem (CID 7993739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).