About 5-[(2,5-dioxo-4-propylpiperazin-1-yl)methyl]-1,2-oxazole-3-carboxylic acid
5-[(2,5-dioxo-4-propylpiperazin-1-yl)methyl]-1,2-oxazole-3-carboxylic acid (PubChem CID 79937560) has the molecular formula C12H15N3O5
and a molecular weight of 281.27 g/mol. Its IUPAC name is 5-[(2,5-dioxo-4-propylpiperazin-1-yl)methyl]-1,2-oxazole-3-carboxylic acid.
Molecular Properties
| Compound Name | 5-[(2,5-dioxo-4-propylpiperazin-1-yl)methyl]-1,2-oxazole-3-carboxylic acid |
| PubChem CID | 79937560 |
| Molecular Formula | C12H15N3O5 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 5-[(2,5-dioxo-4-propylpiperazin-1-yl)methyl]-1,2-oxazole-3-carboxylic acid |
| SMILES | CCCN1CC(=O)N(Cc2cc(C(=O)O)no2)CC1=O |
| InChI | InChI=1S/C12H15N3O5/c1-2-3-14-6-11(17)15(7-10(14)16)5-8-4-9(12(18)19)13-20-8/h4H,2-3,5-7H2,1H3,(H,18,19) |
| InChIKey | QWONBRMMNZGESR-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[(2,5-dioxo-4-propylpiperazin-1-yl)methyl]-1,2-oxazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2,5-dioxo-4-propylpiperazin-1-yl)methyl]-1,2-oxazole-3-carboxylic acid?
The IUPAC name of 5-[(2,5-dioxo-4-propylpiperazin-1-yl)methyl]-1,2-oxazole-3-carboxylic acid (CID 79937560) is 5-[(2,5-dioxo-4-propylpiperazin-1-yl)methyl]-1,2-oxazole-3-carboxylic acid.
What is the SMILES notation for 5-[(2,5-dioxo-4-propylpiperazin-1-yl)methyl]-1,2-oxazole-3-carboxylic acid?
The canonical SMILES for 5-[(2,5-dioxo-4-propylpiperazin-1-yl)methyl]-1,2-oxazole-3-carboxylic acid is CCCN1CC(=O)N(Cc2cc(C(=O)O)no2)CC1=O.
What is the InChIKey of 5-[(2,5-dioxo-4-propylpiperazin-1-yl)methyl]-1,2-oxazole-3-carboxylic acid?
The InChIKey is QWONBRMMNZGESR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3O5/c1-2-3-14-6-11(17)15(7-10(14)16)5-8-4-9(12(18)19)13-20-8/h4H,2-3,5-7H2,1H3,(H,18,19).
What are the key properties of 5-[(2,5-dioxo-4-propylpiperazin-1-yl)methyl]-1,2-oxazole-3-carboxylic acid?
5-[(2,5-dioxo-4-propylpiperazin-1-yl)methyl]-1,2-oxazole-3-carboxylic acid has a molecular weight of 281.27 g/mol, XLogP of -0.05, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2,5-dioxo-4-propylpiperazin-1-yl)methyl]-1,2-oxazole-3-carboxylic acid is sourced from PubChem (CID 79937560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).