C16H31N3O — CID 79937688
[3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-2,2,5,5-tetramethyloxolan-3-yl]methanamine (PubChem CID 79937688) has the molecular formula C16H31N3O and a molecular weight of 281.44 g/mol. Its IUPAC name is [3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-2,2,5,5-tetramethyloxolan-3-yl]methanamine.
| Compound Name | [3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-2,2,5,5-tetramethyloxolan-3-yl]methanamine |
|---|---|
| PubChem CID | 79937688 |
| Molecular Formula | C16H31N3O |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.25 |
| IUPAC Name | [3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-2,2,5,5-tetramethyloxolan-3-yl]methanamine |
| SMILES | CC1(C)CC(CN)(N2CCN3CCCC3C2)C(C)(C)O1 |
| InChI | InChI=1S/C16H31N3O/c1-14(2)11-16(12-17,15(3,4)20-14)19-9-8-18-7-5-6-13(18)10-19/h13H,5-12,17H2,1-4H3 |
| InChIKey | RJIVPOORFYULEF-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |