C14H26N4O — CID 79937729
2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-1-(1,4-diazepan-1-yl)ethanone (PubChem CID 79937729) has the molecular formula C14H26N4O and a molecular weight of 266.39 g/mol. Its IUPAC name is 2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-1-(1,4-diazepan-1-yl)ethanone.
| Compound Name | 2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-1-(1,4-diazepan-1-yl)ethanone |
|---|---|
| PubChem CID | 79937729 |
| Molecular Formula | C14H26N4O |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.21 |
| IUPAC Name | 2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-1-(1,4-diazepan-1-yl)ethanone |
| SMILES | O=C(CN1CCN2CCCC2C1)N1CCCNCC1 |
| InChI | InChI=1S/C14H26N4O/c19-14(18-7-2-4-15-5-8-18)12-16-9-10-17-6-1-3-13(17)11-16/h13,15H,1-12H2 |
| InChIKey | ULIQKDXSLPMZEO-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |