C13H24N2O3 — CID 79938474
methyl 2-hydroxy-2-methyl-3-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)propanoate (PubChem CID 79938474) has the molecular formula C13H24N2O3 and a molecular weight of 256.35 g/mol. Its IUPAC name is methyl 2-hydroxy-2-methyl-3-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)propanoate.
| Compound Name | methyl 2-hydroxy-2-methyl-3-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)propanoate |
|---|---|
| PubChem CID | 79938474 |
| Molecular Formula | C13H24N2O3 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | methyl 2-hydroxy-2-methyl-3-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)propanoate |
| SMILES | COC(=O)C(C)(O)CN1CC2CCCN2CC1C |
| InChI | InChI=1S/C13H24N2O3/c1-10-7-14-6-4-5-11(14)8-15(10)9-13(2,17)12(16)18-3/h10-11,17H,4-9H2,1-3H3 |
| InChIKey | INTIUZUXVWPBOP-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |