C12H16N2O4 — CID 79940497
4-(1,4-dioxo-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazin-2-yl)-3-methylbut-2-enoic acid (PubChem CID 79940497) has the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. Its IUPAC name is 4-(1,4-dioxo-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazin-2-yl)-3-methylbut-2-enoic acid.
| Compound Name | 4-(1,4-dioxo-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazin-2-yl)-3-methylbut-2-enoic acid |
|---|---|
| PubChem CID | 79940497 |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | 4-(1,4-dioxo-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazin-2-yl)-3-methylbut-2-enoic acid |
| SMILES | CC(=CC(=O)O)CN1CC(=O)N2CCCC2C1=O |
| InChI | InChI=1S/C12H16N2O4/c1-8(5-11(16)17)6-13-7-10(15)14-4-2-3-9(14)12(13)18/h5,9H,2-4,6-7H2,1H3,(H,16,17) |
| InChIKey | HXXJYRPKAIGOOK-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|