C14H28N4O — CID 79940703
4-amino-N,N-dimethyl-3-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)butanamide (PubChem CID 79940703) has the molecular formula C14H28N4O and a molecular weight of 268.40 g/mol. Its IUPAC name is 4-amino-N,N-dimethyl-3-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)butanamide.
| Compound Name | 4-amino-N,N-dimethyl-3-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)butanamide |
|---|---|
| PubChem CID | 79940703 |
| Molecular Formula | C14H28N4O |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.23 |
| IUPAC Name | 4-amino-N,N-dimethyl-3-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)butanamide |
| SMILES | CC1CN2CCCC2CN1C(CN)CC(=O)N(C)C |
| InChI | InChI=1S/C14H28N4O/c1-11-9-17-6-4-5-12(17)10-18(11)13(8-15)7-14(19)16(2)3/h11-13H,4-10,15H2,1-3H3 |
| InChIKey | LZUBIUFUHXSSNI-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 52.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |