About 5-bromo-4-methyl-N-(4,4,4-trifluorobutyl)thiophene-2-sulfonamide
5-bromo-4-methyl-N-(4,4,4-trifluorobutyl)thiophene-2-sulfonamide (PubChem CID 79940739) has the molecular formula C9H11BrF3NO2S2
and a molecular weight of 366.22 g/mol. Its IUPAC name is 5-bromo-4-methyl-N-(4,4,4-trifluorobutyl)thiophene-2-sulfonamide.
Molecular Properties
| Compound Name | 5-bromo-4-methyl-N-(4,4,4-trifluorobutyl)thiophene-2-sulfonamide |
| PubChem CID | 79940739 |
| Molecular Formula | C9H11BrF3NO2S2 |
| Molecular Weight | 366.22 g/mol |
| Exact Mass | 364.94 |
| IUPAC Name | 5-bromo-4-methyl-N-(4,4,4-trifluorobutyl)thiophene-2-sulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NCCCC(F)(F)F)sc1Br |
| InChI | InChI=1S/C9H11BrF3NO2S2/c1-6-5-7(17-8(6)10)18(15,16)14-4-2-3-9(11,12)13/h5,14H,2-4H2,1H3 |
| InChIKey | PQRCKSCAXIKKPH-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.22 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-4-methyl-N-(4,4,4-trifluorobutyl)thiophene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-4-methyl-N-(4,4,4-trifluorobutyl)thiophene-2-sulfonamide?
The IUPAC name of 5-bromo-4-methyl-N-(4,4,4-trifluorobutyl)thiophene-2-sulfonamide (CID 79940739) is 5-bromo-4-methyl-N-(4,4,4-trifluorobutyl)thiophene-2-sulfonamide.
What is the SMILES notation for 5-bromo-4-methyl-N-(4,4,4-trifluorobutyl)thiophene-2-sulfonamide?
The canonical SMILES for 5-bromo-4-methyl-N-(4,4,4-trifluorobutyl)thiophene-2-sulfonamide is Cc1cc(S(=O)(=O)NCCCC(F)(F)F)sc1Br.
What is the InChIKey of 5-bromo-4-methyl-N-(4,4,4-trifluorobutyl)thiophene-2-sulfonamide?
The InChIKey is PQRCKSCAXIKKPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11BrF3NO2S2/c1-6-5-7(17-8(6)10)18(15,16)14-4-2-3-9(11,12)13/h5,14H,2-4H2,1H3.
What are the key properties of 5-bromo-4-methyl-N-(4,4,4-trifluorobutyl)thiophene-2-sulfonamide?
5-bromo-4-methyl-N-(4,4,4-trifluorobutyl)thiophene-2-sulfonamide has a molecular weight of 366.22 g/mol, XLogP of 3.44, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-4-methyl-N-(4,4,4-trifluorobutyl)thiophene-2-sulfonamide is sourced from PubChem (CID 79940739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).