C11H14N2O4 — CID 79940944
(E)-4-(1,4-dioxo-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazin-2-yl)but-2-enoic acid (PubChem CID 79940944) has the molecular formula C11H14N2O4 and a molecular weight of 238.24 g/mol. Its IUPAC name is (E)-4-(1,4-dioxo-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazin-2-yl)but-2-enoic acid.
| Compound Name | (E)-4-(1,4-dioxo-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazin-2-yl)but-2-enoic acid |
|---|---|
| PubChem CID | 79940944 |
| Molecular Formula | C11H14N2O4 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | (E)-4-(1,4-dioxo-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazin-2-yl)but-2-enoic acid |
| SMILES | O=C(O)/C=C/CN1CC(=O)N2CCCC2C1=O |
| InChI | InChI=1S/C11H14N2O4/c14-9-7-12(5-2-4-10(15)16)11(17)8-3-1-6-13(8)9/h2,4,8H,1,3,5-7H2,(H,15,16)/b4-2+ |
| InChIKey | UHIYCRUJTLAXBK-DUXPYHPUSA-N |
| XLogP | -0.54 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|