C13H19N5O2 — CID 79941401
1-[(2-hydrazinyl-4-pyridinyl)methyl]-4-propylpiperazine-2,5-dione (PubChem CID 79941401) has the molecular formula C13H19N5O2 and a molecular weight of 277.33 g/mol. Its IUPAC name is 1-[(2-hydrazinyl-4-pyridinyl)methyl]-4-propylpiperazine-2,5-dione.
| Compound Name | 1-[(2-hydrazinyl-4-pyridinyl)methyl]-4-propylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 79941401 |
| Molecular Formula | C13H19N5O2 |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 1-[(2-hydrazinyl-4-pyridinyl)methyl]-4-propylpiperazine-2,5-dione |
| SMILES | CCCN1CC(=O)N(Cc2ccnc(NN)c2)CC1=O |
| InChI | InChI=1S/C13H19N5O2/c1-2-5-17-8-13(20)18(9-12(17)19)7-10-3-4-15-11(6-10)16-14/h3-4,6H,2,5,7-9,14H2,1H3,(H,15,16) |
| InChIKey | DDWCBZPUBNPNOZ-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|