About 2,2-dimethyl-3-(4-methyl-2,5-dioxopiperazin-1-yl)propanehydrazide
2,2-dimethyl-3-(4-methyl-2,5-dioxopiperazin-1-yl)propanehydrazide (PubChem CID 79941768) has the molecular formula C10H18N4O3
and a molecular weight of 242.28 g/mol. Its IUPAC name is 2,2-dimethyl-3-(4-methyl-2,5-dioxopiperazin-1-yl)propanehydrazide.
Molecular Properties
| Compound Name | 2,2-dimethyl-3-(4-methyl-2,5-dioxopiperazin-1-yl)propanehydrazide |
| PubChem CID | 79941768 |
| Molecular Formula | C10H18N4O3 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | 2,2-dimethyl-3-(4-methyl-2,5-dioxopiperazin-1-yl)propanehydrazide |
| SMILES | CN1CC(=O)N(CC(C)(C)C(=O)NN)CC1=O |
| InChI | InChI=1S/C10H18N4O3/c1-10(2,9(17)12-11)6-14-5-7(15)13(3)4-8(14)16/h4-6,11H2,1-3H3,(H,12,17) |
| InChIKey | KHNXPCVLNYQDKF-UHFFFAOYSA-N |
| XLogP | -1.70 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethyl-3-(4-methyl-2,5-dioxopiperazin-1-yl)propanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-3-(4-methyl-2,5-dioxopiperazin-1-yl)propanehydrazide?
The IUPAC name of 2,2-dimethyl-3-(4-methyl-2,5-dioxopiperazin-1-yl)propanehydrazide (CID 79941768) is 2,2-dimethyl-3-(4-methyl-2,5-dioxopiperazin-1-yl)propanehydrazide.
What is the SMILES notation for 2,2-dimethyl-3-(4-methyl-2,5-dioxopiperazin-1-yl)propanehydrazide?
The canonical SMILES for 2,2-dimethyl-3-(4-methyl-2,5-dioxopiperazin-1-yl)propanehydrazide is CN1CC(=O)N(CC(C)(C)C(=O)NN)CC1=O.
What is the InChIKey of 2,2-dimethyl-3-(4-methyl-2,5-dioxopiperazin-1-yl)propanehydrazide?
The InChIKey is KHNXPCVLNYQDKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N4O3/c1-10(2,9(17)12-11)6-14-5-7(15)13(3)4-8(14)16/h4-6,11H2,1-3H3,(H,12,17).
What are the key properties of 2,2-dimethyl-3-(4-methyl-2,5-dioxopiperazin-1-yl)propanehydrazide?
2,2-dimethyl-3-(4-methyl-2,5-dioxopiperazin-1-yl)propanehydrazide has a molecular weight of 242.28 g/mol, XLogP of -1.70, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-3-(4-methyl-2,5-dioxopiperazin-1-yl)propanehydrazide is sourced from PubChem (CID 79941768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).