C13H16N2S2 — CID 79942790
N-(1,3-benzothiazol-2-ylmethyl)-5-methylthiolan-3-amine (PubChem CID 79942790) has the molecular formula C13H16N2S2 and a molecular weight of 264.42 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-ylmethyl)-5-methylthiolan-3-amine.
| Compound Name | N-(1,3-benzothiazol-2-ylmethyl)-5-methylthiolan-3-amine |
|---|---|
| PubChem CID | 79942790 |
| Molecular Formula | C13H16N2S2 |
| Molecular Weight | 264.42 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | N-(1,3-benzothiazol-2-ylmethyl)-5-methylthiolan-3-amine |
| SMILES | CC1CC(NCc2nc3ccccc3s2)CS1 |
| InChI | InChI=1S/C13H16N2S2/c1-9-6-10(8-16-9)14-7-13-15-11-4-2-3-5-12(11)17-13/h2-5,9-10,14H,6-8H2,1H3 |
| InChIKey | VLWOVOQSCQPSFI-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.42 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |