C12H22N2O3 — CID 79943628
methyl 3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-2-hydroxy-2-methylpropanoate (PubChem CID 79943628) has the molecular formula C12H22N2O3 and a molecular weight of 242.32 g/mol. Its IUPAC name is methyl 3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-2-hydroxy-2-methylpropanoate.
| Compound Name | methyl 3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-2-hydroxy-2-methylpropanoate |
|---|---|
| PubChem CID | 79943628 |
| Molecular Formula | C12H22N2O3 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | methyl 3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-2-hydroxy-2-methylpropanoate |
| SMILES | COC(=O)C(C)(O)CN1CCN2CCCC2C1 |
| InChI | InChI=1S/C12H22N2O3/c1-12(16,11(15)17-2)9-13-6-7-14-5-3-4-10(14)8-13/h10,16H,3-9H2,1-2H3 |
| InChIKey | MSYAVHFAGAVMTE-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |