C10H13F3N2O2 — CID 79944572
2-(3,3,3-trifluoropropyl)-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazine-1,4-dione (PubChem CID 79944572) has the molecular formula C10H13F3N2O2 and a molecular weight of 250.22 g/mol. Its IUPAC name is 2-(3,3,3-trifluoropropyl)-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazine-1,4-dione.
| Compound Name | 2-(3,3,3-trifluoropropyl)-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazine-1,4-dione |
|---|---|
| PubChem CID | 79944572 |
| Molecular Formula | C10H13F3N2O2 |
| Molecular Weight | 250.22 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 2-(3,3,3-trifluoropropyl)-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazine-1,4-dione |
| SMILES | O=C1C2CCCN2C(=O)CN1CCC(F)(F)F |
| InChI | InChI=1S/C10H13F3N2O2/c11-10(12,13)3-5-14-6-8(16)15-4-1-2-7(15)9(14)17/h7H,1-6H2 |
| InChIKey | VNJIMWFYFNMDGG-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.22 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |