C17H35N3 — CID 79945206
6-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-N-tert-butylhexan-1-amine (PubChem CID 79945206) has the molecular formula C17H35N3 and a molecular weight of 281.49 g/mol. Its IUPAC name is 6-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-N-tert-butylhexan-1-amine.
| Compound Name | 6-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-N-tert-butylhexan-1-amine |
|---|---|
| PubChem CID | 79945206 |
| Molecular Formula | C17H35N3 |
| Molecular Weight | 281.49 g/mol |
| Exact Mass | 281.28 |
| IUPAC Name | 6-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-N-tert-butylhexan-1-amine |
| SMILES | CC(C)(C)NCCCCCCN1CCN2CCCC2C1 |
| InChI | InChI=1S/C17H35N3/c1-17(2,3)18-10-6-4-5-7-11-19-13-14-20-12-8-9-16(20)15-19/h16,18H,4-15H2,1-3H3 |
| InChIKey | PDDDLEKWNJIBKC-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.49 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|