C17H35N3 — CID 79945731
2-methyl-2-[(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)methyl]-N-propan-2-ylbutan-1-amine (PubChem CID 79945731) has the molecular formula C17H35N3 and a molecular weight of 281.49 g/mol. Its IUPAC name is 2-methyl-2-[(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)methyl]-N-propan-2-ylbutan-1-amine.
| Compound Name | 2-methyl-2-[(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)methyl]-N-propan-2-ylbutan-1-amine |
|---|---|
| PubChem CID | 79945731 |
| Molecular Formula | C17H35N3 |
| Molecular Weight | 281.49 g/mol |
| Exact Mass | 281.28 |
| IUPAC Name | 2-methyl-2-[(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)methyl]-N-propan-2-ylbutan-1-amine |
| SMILES | CCC(C)(CNC(C)C)CN1CC2CCCN2CC1C |
| InChI | InChI=1S/C17H35N3/c1-6-17(5,12-18-14(2)3)13-20-11-16-8-7-9-19(16)10-15(20)4/h14-16,18H,6-13H2,1-5H3 |
| InChIKey | OPQKDSZHDHXVAN-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.49 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |