C14H28N2S — CID 79946619
2-[1-(5,5-dimethylthian-3-yl)piperidin-4-yl]ethanamine (PubChem CID 79946619) has the molecular formula C14H28N2S and a molecular weight of 256.46 g/mol. Its IUPAC name is 2-[1-(5,5-dimethylthian-3-yl)piperidin-4-yl]ethanamine.
| Compound Name | 2-[1-(5,5-dimethylthian-3-yl)piperidin-4-yl]ethanamine |
|---|---|
| PubChem CID | 79946619 |
| Molecular Formula | C14H28N2S |
| Molecular Weight | 256.46 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | 2-[1-(5,5-dimethylthian-3-yl)piperidin-4-yl]ethanamine |
| SMILES | CC1(C)CSCC(N2CCC(CCN)CC2)C1 |
| InChI | InChI=1S/C14H28N2S/c1-14(2)9-13(10-17-11-14)16-7-4-12(3-6-15)5-8-16/h12-13H,3-11,15H2,1-2H3 |
| InChIKey | JOVOIAAIAZWECH-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.46 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |