About 1-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)-methylamino]-2-methylpropan-2-ol
1-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)-methylamino]-2-methylpropan-2-ol (PubChem CID 79946664) has the molecular formula C11H15BrN4O
and a molecular weight of 299.17 g/mol. Its IUPAC name is 1-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)-methylamino]-2-methylpropan-2-ol.
Molecular Properties
| Compound Name | 1-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)-methylamino]-2-methylpropan-2-ol |
| PubChem CID | 79946664 |
| Molecular Formula | C11H15BrN4O |
| Molecular Weight | 299.17 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 1-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)-methylamino]-2-methylpropan-2-ol |
| SMILES | CN(CC(C)(C)O)c1nc(Br)cn2ccnc12 |
| InChI | InChI=1S/C11H15BrN4O/c1-11(2,17)7-15(3)10-9-13-4-5-16(9)6-8(12)14-10/h4-6,17H,7H2,1-3H3 |
| InChIKey | HMCLNLQJCSCRJR-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 53.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.17 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)-methylamino]-2-methylpropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)-methylamino]-2-methylpropan-2-ol?
The IUPAC name of 1-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)-methylamino]-2-methylpropan-2-ol (CID 79946664) is 1-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)-methylamino]-2-methylpropan-2-ol.
What is the SMILES notation for 1-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)-methylamino]-2-methylpropan-2-ol?
The canonical SMILES for 1-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)-methylamino]-2-methylpropan-2-ol is CN(CC(C)(C)O)c1nc(Br)cn2ccnc12.
What is the InChIKey of 1-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)-methylamino]-2-methylpropan-2-ol?
The InChIKey is HMCLNLQJCSCRJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15BrN4O/c1-11(2,17)7-15(3)10-9-13-4-5-16(9)6-8(12)14-10/h4-6,17H,7H2,1-3H3.
What are the key properties of 1-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)-methylamino]-2-methylpropan-2-ol?
1-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)-methylamino]-2-methylpropan-2-ol has a molecular weight of 299.17 g/mol, XLogP of 1.70, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)-methylamino]-2-methylpropan-2-ol is sourced from PubChem (CID 79946664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).