About 3-[(2,4-difluorophenyl)methyl]-5,5-dimethylthian-3-ol
3-[(2,4-difluorophenyl)methyl]-5,5-dimethylthian-3-ol (PubChem CID 79946811) has the molecular formula C14H18F2OS
and a molecular weight of 272.36 g/mol. Its IUPAC name is 3-[(2,4-difluorophenyl)methyl]-5,5-dimethylthian-3-ol.
Molecular Properties
| Compound Name | 3-[(2,4-difluorophenyl)methyl]-5,5-dimethylthian-3-ol |
| PubChem CID | 79946811 |
| Molecular Formula | C14H18F2OS |
| Molecular Weight | 272.36 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 3-[(2,4-difluorophenyl)methyl]-5,5-dimethylthian-3-ol |
| SMILES | CC1(C)CSCC(O)(Cc2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C14H18F2OS/c1-13(2)7-14(17,9-18-8-13)6-10-3-4-11(15)5-12(10)16/h3-5,17H,6-9H2,1-2H3 |
| InChIKey | WGVDKAIQIZOGPP-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.36 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[(2,4-difluorophenyl)methyl]-5,5-dimethylthian-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2,4-difluorophenyl)methyl]-5,5-dimethylthian-3-ol?
The IUPAC name of 3-[(2,4-difluorophenyl)methyl]-5,5-dimethylthian-3-ol (CID 79946811) is 3-[(2,4-difluorophenyl)methyl]-5,5-dimethylthian-3-ol.
What is the SMILES notation for 3-[(2,4-difluorophenyl)methyl]-5,5-dimethylthian-3-ol?
The canonical SMILES for 3-[(2,4-difluorophenyl)methyl]-5,5-dimethylthian-3-ol is CC1(C)CSCC(O)(Cc2ccc(F)cc2F)C1.
What is the InChIKey of 3-[(2,4-difluorophenyl)methyl]-5,5-dimethylthian-3-ol?
The InChIKey is WGVDKAIQIZOGPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18F2OS/c1-13(2)7-14(17,9-18-8-13)6-10-3-4-11(15)5-12(10)16/h3-5,17H,6-9H2,1-2H3.
What are the key properties of 3-[(2,4-difluorophenyl)methyl]-5,5-dimethylthian-3-ol?
3-[(2,4-difluorophenyl)methyl]-5,5-dimethylthian-3-ol has a molecular weight of 272.36 g/mol, XLogP of 3.40, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,4-difluorophenyl)methyl]-5,5-dimethylthian-3-ol is sourced from PubChem (CID 79946811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).