C14H18F2OS — CID 79946811
3-[(2,4-difluorophenyl)methyl]-5,5-dimethylthian-3-ol (PubChem CID 79946811) has the molecular formula C14H18F2OS and a molecular weight of 272.36 g/mol. Its IUPAC name is 3-[(2,4-difluorophenyl)methyl]-5,5-dimethylthian-3-ol.
| Compound Name | 3-[(2,4-difluorophenyl)methyl]-5,5-dimethylthian-3-ol |
|---|---|
| PubChem CID | 79946811 |
| Molecular Formula | C14H18F2OS |
| Molecular Weight | 272.36 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 3-[(2,4-difluorophenyl)methyl]-5,5-dimethylthian-3-ol |
| SMILES | CC1(C)CSCC(O)(Cc2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C14H18F2OS/c1-13(2)7-14(17,9-18-8-13)6-10-3-4-11(15)5-12(10)16/h3-5,17H,6-9H2,1-2H3 |
| InChIKey | WGVDKAIQIZOGPP-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.36 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |