About 3-[1-(ethylamino)ethyl]-5,5-dimethylthian-3-ol
3-[1-(ethylamino)ethyl]-5,5-dimethylthian-3-ol (PubChem CID 79946812) has the molecular formula C11H23NOS
and a molecular weight of 217.38 g/mol. Its IUPAC name is 3-[1-(ethylamino)ethyl]-5,5-dimethylthian-3-ol.
Molecular Properties
| Compound Name | 3-[1-(ethylamino)ethyl]-5,5-dimethylthian-3-ol |
| PubChem CID | 79946812 |
| Molecular Formula | C11H23NOS |
| Molecular Weight | 217.38 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 3-[1-(ethylamino)ethyl]-5,5-dimethylthian-3-ol |
| SMILES | CCNC(C)C1(O)CSCC(C)(C)C1 |
| InChI | InChI=1S/C11H23NOS/c1-5-12-9(2)11(13)6-10(3,4)7-14-8-11/h9,12-13H,5-8H2,1-4H3 |
| InChIKey | AFJBEAOYHFGDAA-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.38 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[1-(ethylamino)ethyl]-5,5-dimethylthian-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-(ethylamino)ethyl]-5,5-dimethylthian-3-ol?
The IUPAC name of 3-[1-(ethylamino)ethyl]-5,5-dimethylthian-3-ol (CID 79946812) is 3-[1-(ethylamino)ethyl]-5,5-dimethylthian-3-ol.
What is the SMILES notation for 3-[1-(ethylamino)ethyl]-5,5-dimethylthian-3-ol?
The canonical SMILES for 3-[1-(ethylamino)ethyl]-5,5-dimethylthian-3-ol is CCNC(C)C1(O)CSCC(C)(C)C1.
What is the InChIKey of 3-[1-(ethylamino)ethyl]-5,5-dimethylthian-3-ol?
The InChIKey is AFJBEAOYHFGDAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NOS/c1-5-12-9(2)11(13)6-10(3,4)7-14-8-11/h9,12-13H,5-8H2,1-4H3.
What are the key properties of 3-[1-(ethylamino)ethyl]-5,5-dimethylthian-3-ol?
3-[1-(ethylamino)ethyl]-5,5-dimethylthian-3-ol has a molecular weight of 217.38 g/mol, XLogP of 1.88, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(ethylamino)ethyl]-5,5-dimethylthian-3-ol is sourced from PubChem (CID 79946812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).