About 2-(5,5-dimethylthian-3-ylidene)ethanamine
2-(5,5-dimethylthian-3-ylidene)ethanamine (PubChem CID 79946853) has the molecular formula C9H17NS
and a molecular weight of 171.31 g/mol. Its IUPAC name is 2-(5,5-dimethylthian-3-ylidene)ethanamine.
Molecular Properties
| Compound Name | 2-(5,5-dimethylthian-3-ylidene)ethanamine |
| PubChem CID | 79946853 |
| Molecular Formula | C9H17NS |
| Molecular Weight | 171.31 g/mol |
| Exact Mass | 171.11 |
| IUPAC Name | 2-(5,5-dimethylthian-3-ylidene)ethanamine |
| SMILES | CC1(C)CSCC(=CCN)C1 |
| InChI | InChI=1S/C9H17NS/c1-9(2)5-8(3-4-10)6-11-7-9/h3H,4-7,10H2,1-2H3 |
| InChIKey | MSCPQMDZFFDRIG-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.31 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(5,5-dimethylthian-3-ylidene)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5,5-dimethylthian-3-ylidene)ethanamine?
The IUPAC name of 2-(5,5-dimethylthian-3-ylidene)ethanamine (CID 79946853) is 2-(5,5-dimethylthian-3-ylidene)ethanamine.
What is the SMILES notation for 2-(5,5-dimethylthian-3-ylidene)ethanamine?
The canonical SMILES for 2-(5,5-dimethylthian-3-ylidene)ethanamine is CC1(C)CSCC(=CCN)C1.
What is the InChIKey of 2-(5,5-dimethylthian-3-ylidene)ethanamine?
The InChIKey is MSCPQMDZFFDRIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NS/c1-9(2)5-8(3-4-10)6-11-7-9/h3H,4-7,10H2,1-2H3.
What are the key properties of 2-(5,5-dimethylthian-3-ylidene)ethanamine?
2-(5,5-dimethylthian-3-ylidene)ethanamine has a molecular weight of 171.31 g/mol, XLogP of 2.03, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5,5-dimethylthian-3-ylidene)ethanamine is sourced from PubChem (CID 79946853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).