About 4-(6-bromoimidazo[1,2-a]pyrazin-8-yl)-2,6-dimethylthiomorpholine
4-(6-bromoimidazo[1,2-a]pyrazin-8-yl)-2,6-dimethylthiomorpholine (PubChem CID 79946928) has the molecular formula C12H15BrN4S
and a molecular weight of 327.25 g/mol. Its IUPAC name is 4-(6-bromoimidazo[1,2-a]pyrazin-8-yl)-2,6-dimethylthiomorpholine.
Molecular Properties
| Compound Name | 4-(6-bromoimidazo[1,2-a]pyrazin-8-yl)-2,6-dimethylthiomorpholine |
| PubChem CID | 79946928 |
| Molecular Formula | C12H15BrN4S |
| Molecular Weight | 327.25 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | 4-(6-bromoimidazo[1,2-a]pyrazin-8-yl)-2,6-dimethylthiomorpholine |
| SMILES | CC1CN(c2nc(Br)cn3ccnc23)CC(C)S1 |
| InChI | InChI=1S/C12H15BrN4S/c1-8-5-17(6-9(2)18-8)12-11-14-3-4-16(11)7-10(13)15-12/h3-4,7-9H,5-6H2,1-2H3 |
| InChIKey | CGLJXOVZSDWRFA-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 33.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.25 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(6-bromoimidazo[1,2-a]pyrazin-8-yl)-2,6-dimethylthiomorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(6-bromoimidazo[1,2-a]pyrazin-8-yl)-2,6-dimethylthiomorpholine?
The IUPAC name of 4-(6-bromoimidazo[1,2-a]pyrazin-8-yl)-2,6-dimethylthiomorpholine (CID 79946928) is 4-(6-bromoimidazo[1,2-a]pyrazin-8-yl)-2,6-dimethylthiomorpholine.
What is the SMILES notation for 4-(6-bromoimidazo[1,2-a]pyrazin-8-yl)-2,6-dimethylthiomorpholine?
The canonical SMILES for 4-(6-bromoimidazo[1,2-a]pyrazin-8-yl)-2,6-dimethylthiomorpholine is CC1CN(c2nc(Br)cn3ccnc23)CC(C)S1.
What is the InChIKey of 4-(6-bromoimidazo[1,2-a]pyrazin-8-yl)-2,6-dimethylthiomorpholine?
The InChIKey is CGLJXOVZSDWRFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15BrN4S/c1-8-5-17(6-9(2)18-8)12-11-14-3-4-16(11)7-10(13)15-12/h3-4,7-9H,5-6H2,1-2H3.
What are the key properties of 4-(6-bromoimidazo[1,2-a]pyrazin-8-yl)-2,6-dimethylthiomorpholine?
4-(6-bromoimidazo[1,2-a]pyrazin-8-yl)-2,6-dimethylthiomorpholine has a molecular weight of 327.25 g/mol, XLogP of 2.82, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(6-bromoimidazo[1,2-a]pyrazin-8-yl)-2,6-dimethylthiomorpholine is sourced from PubChem (CID 79946928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).