About 6-bromo-N-[(2,5-difluorophenyl)methyl]imidazo[1,2-a]pyrazin-8-amine
6-bromo-N-[(2,5-difluorophenyl)methyl]imidazo[1,2-a]pyrazin-8-amine (PubChem CID 79947018) has the molecular formula C13H9BrF2N4
and a molecular weight of 339.14 g/mol. Its IUPAC name is 6-bromo-N-[(2,5-difluorophenyl)methyl]imidazo[1,2-a]pyrazin-8-amine.
Molecular Properties
| Compound Name | 6-bromo-N-[(2,5-difluorophenyl)methyl]imidazo[1,2-a]pyrazin-8-amine |
| PubChem CID | 79947018 |
| Molecular Formula | C13H9BrF2N4 |
| Molecular Weight | 339.14 g/mol |
| Exact Mass | 338.00 |
| IUPAC Name | 6-bromo-N-[(2,5-difluorophenyl)methyl]imidazo[1,2-a]pyrazin-8-amine |
| SMILES | Fc1ccc(F)c(CNc2nc(Br)cn3ccnc23)c1 |
| InChI | InChI=1S/C13H9BrF2N4/c14-11-7-20-4-3-17-13(20)12(19-11)18-6-8-5-9(15)1-2-10(8)16/h1-5,7H,6H2,(H,18,19) |
| InChIKey | FYGDXCUIPXEHNB-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.14 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-bromo-N-[(2,5-difluorophenyl)methyl]imidazo[1,2-a]pyrazin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-N-[(2,5-difluorophenyl)methyl]imidazo[1,2-a]pyrazin-8-amine?
The IUPAC name of 6-bromo-N-[(2,5-difluorophenyl)methyl]imidazo[1,2-a]pyrazin-8-amine (CID 79947018) is 6-bromo-N-[(2,5-difluorophenyl)methyl]imidazo[1,2-a]pyrazin-8-amine.
What is the SMILES notation for 6-bromo-N-[(2,5-difluorophenyl)methyl]imidazo[1,2-a]pyrazin-8-amine?
The canonical SMILES for 6-bromo-N-[(2,5-difluorophenyl)methyl]imidazo[1,2-a]pyrazin-8-amine is Fc1ccc(F)c(CNc2nc(Br)cn3ccnc23)c1.
What is the InChIKey of 6-bromo-N-[(2,5-difluorophenyl)methyl]imidazo[1,2-a]pyrazin-8-amine?
The InChIKey is FYGDXCUIPXEHNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9BrF2N4/c14-11-7-20-4-3-17-13(20)12(19-11)18-6-8-5-9(15)1-2-10(8)16/h1-5,7H,6H2,(H,18,19).
What are the key properties of 6-bromo-N-[(2,5-difluorophenyl)methyl]imidazo[1,2-a]pyrazin-8-amine?
6-bromo-N-[(2,5-difluorophenyl)methyl]imidazo[1,2-a]pyrazin-8-amine has a molecular weight of 339.14 g/mol, XLogP of 3.38, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-N-[(2,5-difluorophenyl)methyl]imidazo[1,2-a]pyrazin-8-amine is sourced from PubChem (CID 79947018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).