About 4,4-dimethyl-2-thia-9-azaspiro[5.5]undecane-8,10-dione
4,4-dimethyl-2-thia-9-azaspiro[5.5]undecane-8,10-dione (PubChem CID 79947309) has the molecular formula C11H17NO2S
and a molecular weight of 227.33 g/mol. Its IUPAC name is 4,4-dimethyl-2-thia-9-azaspiro[5.5]undecane-8,10-dione.
Molecular Properties
| Compound Name | 4,4-dimethyl-2-thia-9-azaspiro[5.5]undecane-8,10-dione |
| PubChem CID | 79947309 |
| Molecular Formula | C11H17NO2S |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | 4,4-dimethyl-2-thia-9-azaspiro[5.5]undecane-8,10-dione |
| SMILES | CC1(C)CSCC2(CC(=O)NC(=O)C2)C1 |
| InChI | InChI=1S/C11H17NO2S/c1-10(2)5-11(7-15-6-10)3-8(13)12-9(14)4-11/h3-7H2,1-2H3,(H,12,13,14) |
| InChIKey | VAXWIYJXCPUNTC-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4,4-dimethyl-2-thia-9-azaspiro[5.5]undecane-8,10-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-dimethyl-2-thia-9-azaspiro[5.5]undecane-8,10-dione?
The IUPAC name of 4,4-dimethyl-2-thia-9-azaspiro[5.5]undecane-8,10-dione (CID 79947309) is 4,4-dimethyl-2-thia-9-azaspiro[5.5]undecane-8,10-dione.
What is the SMILES notation for 4,4-dimethyl-2-thia-9-azaspiro[5.5]undecane-8,10-dione?
The canonical SMILES for 4,4-dimethyl-2-thia-9-azaspiro[5.5]undecane-8,10-dione is CC1(C)CSCC2(CC(=O)NC(=O)C2)C1.
What is the InChIKey of 4,4-dimethyl-2-thia-9-azaspiro[5.5]undecane-8,10-dione?
The InChIKey is VAXWIYJXCPUNTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO2S/c1-10(2)5-11(7-15-6-10)3-8(13)12-9(14)4-11/h3-7H2,1-2H3,(H,12,13,14).
What are the key properties of 4,4-dimethyl-2-thia-9-azaspiro[5.5]undecane-8,10-dione?
4,4-dimethyl-2-thia-9-azaspiro[5.5]undecane-8,10-dione has a molecular weight of 227.33 g/mol, XLogP of 1.57, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dimethyl-2-thia-9-azaspiro[5.5]undecane-8,10-dione is sourced from PubChem (CID 79947309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).