C16H27NO2S — CID 79947318
1-(5,5-dimethylthian-3-yl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid (PubChem CID 79947318) has the molecular formula C16H27NO2S and a molecular weight of 297.46 g/mol. Its IUPAC name is 1-(5,5-dimethylthian-3-yl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid.
| Compound Name | 1-(5,5-dimethylthian-3-yl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 79947318 |
| Molecular Formula | C16H27NO2S |
| Molecular Weight | 297.46 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | 1-(5,5-dimethylthian-3-yl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
| SMILES | CC1(C)CSCC(N2C(C(=O)O)CC3CCCCC32)C1 |
| InChI | InChI=1S/C16H27NO2S/c1-16(2)8-12(9-20-10-16)17-13-6-4-3-5-11(13)7-14(17)15(18)19/h11-14H,3-10H2,1-2H3,(H,18,19) |
| InChIKey | GVPPZXNCUMWPBD-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.46 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |