About 3-[(2-amino-4-pyridinyl)methyl]-5,5-dimethylthian-3-ol
3-[(2-amino-4-pyridinyl)methyl]-5,5-dimethylthian-3-ol (PubChem CID 79947377) has the molecular formula C13H20N2OS
and a molecular weight of 252.38 g/mol. Its IUPAC name is 3-[(2-amino-4-pyridinyl)methyl]-5,5-dimethylthian-3-ol.
Molecular Properties
| Compound Name | 3-[(2-amino-4-pyridinyl)methyl]-5,5-dimethylthian-3-ol |
| PubChem CID | 79947377 |
| Molecular Formula | C13H20N2OS |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 3-[(2-amino-4-pyridinyl)methyl]-5,5-dimethylthian-3-ol |
| SMILES | CC1(C)CSCC(O)(Cc2ccnc(N)c2)C1 |
| InChI | InChI=1S/C13H20N2OS/c1-12(2)7-13(16,9-17-8-12)6-10-3-4-15-11(14)5-10/h3-5,16H,6-9H2,1-2H3,(H2,14,15) |
| InChIKey | QJHDNSPVGAPKSO-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(2-amino-4-pyridinyl)methyl]-5,5-dimethylthian-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2-amino-4-pyridinyl)methyl]-5,5-dimethylthian-3-ol?
The IUPAC name of 3-[(2-amino-4-pyridinyl)methyl]-5,5-dimethylthian-3-ol (CID 79947377) is 3-[(2-amino-4-pyridinyl)methyl]-5,5-dimethylthian-3-ol.
What is the SMILES notation for 3-[(2-amino-4-pyridinyl)methyl]-5,5-dimethylthian-3-ol?
The canonical SMILES for 3-[(2-amino-4-pyridinyl)methyl]-5,5-dimethylthian-3-ol is CC1(C)CSCC(O)(Cc2ccnc(N)c2)C1.
What is the InChIKey of 3-[(2-amino-4-pyridinyl)methyl]-5,5-dimethylthian-3-ol?
The InChIKey is QJHDNSPVGAPKSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2OS/c1-12(2)7-13(16,9-17-8-12)6-10-3-4-15-11(14)5-10/h3-5,16H,6-9H2,1-2H3,(H2,14,15).
What are the key properties of 3-[(2-amino-4-pyridinyl)methyl]-5,5-dimethylthian-3-ol?
3-[(2-amino-4-pyridinyl)methyl]-5,5-dimethylthian-3-ol has a molecular weight of 252.38 g/mol, XLogP of 2.10, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-amino-4-pyridinyl)methyl]-5,5-dimethylthian-3-ol is sourced from PubChem (CID 79947377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).