About 3-(aminomethyl)-N-(2,2-dicyclopropylethyl)-4,4-dimethylthian-3-amine
3-(aminomethyl)-N-(2,2-dicyclopropylethyl)-4,4-dimethylthian-3-amine (PubChem CID 79948397) has the molecular formula C16H30N2S
and a molecular weight of 282.50 g/mol. Its IUPAC name is 3-(aminomethyl)-N-(2,2-dicyclopropylethyl)-4,4-dimethylthian-3-amine.
Molecular Properties
| Compound Name | 3-(aminomethyl)-N-(2,2-dicyclopropylethyl)-4,4-dimethylthian-3-amine |
| PubChem CID | 79948397 |
| Molecular Formula | C16H30N2S |
| Molecular Weight | 282.50 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | 3-(aminomethyl)-N-(2,2-dicyclopropylethyl)-4,4-dimethylthian-3-amine |
| SMILES | CC1(C)CCSCC1(CN)NCC(C1CC1)C1CC1 |
| InChI | InChI=1S/C16H30N2S/c1-15(2)7-8-19-11-16(15,10-17)18-9-14(12-3-4-12)13-5-6-13/h12-14,18H,3-11,17H2,1-2H3 |
| InChIKey | MPAHZIRPWSKPJP-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.50 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(aminomethyl)-N-(2,2-dicyclopropylethyl)-4,4-dimethylthian-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(aminomethyl)-N-(2,2-dicyclopropylethyl)-4,4-dimethylthian-3-amine?
The IUPAC name of 3-(aminomethyl)-N-(2,2-dicyclopropylethyl)-4,4-dimethylthian-3-amine (CID 79948397) is 3-(aminomethyl)-N-(2,2-dicyclopropylethyl)-4,4-dimethylthian-3-amine.
What is the SMILES notation for 3-(aminomethyl)-N-(2,2-dicyclopropylethyl)-4,4-dimethylthian-3-amine?
The canonical SMILES for 3-(aminomethyl)-N-(2,2-dicyclopropylethyl)-4,4-dimethylthian-3-amine is CC1(C)CCSCC1(CN)NCC(C1CC1)C1CC1.
What is the InChIKey of 3-(aminomethyl)-N-(2,2-dicyclopropylethyl)-4,4-dimethylthian-3-amine?
The InChIKey is MPAHZIRPWSKPJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30N2S/c1-15(2)7-8-19-11-16(15,10-17)18-9-14(12-3-4-12)13-5-6-13/h12-14,18H,3-11,17H2,1-2H3.
What are the key properties of 3-(aminomethyl)-N-(2,2-dicyclopropylethyl)-4,4-dimethylthian-3-amine?
3-(aminomethyl)-N-(2,2-dicyclopropylethyl)-4,4-dimethylthian-3-amine has a molecular weight of 282.50 g/mol, XLogP of 2.87, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(aminomethyl)-N-(2,2-dicyclopropylethyl)-4,4-dimethylthian-3-amine is sourced from PubChem (CID 79948397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).