C10H17F3N2OS — CID 79948744
4,4-dimethyl-3-(2,2,2-trifluoroethylamino)thiane-3-carboxamide (PubChem CID 79948744) has the molecular formula C10H17F3N2OS and a molecular weight of 270.32 g/mol. Its IUPAC name is 4,4-dimethyl-3-(2,2,2-trifluoroethylamino)thiane-3-carboxamide.
| Compound Name | 4,4-dimethyl-3-(2,2,2-trifluoroethylamino)thiane-3-carboxamide |
|---|---|
| PubChem CID | 79948744 |
| Molecular Formula | C10H17F3N2OS |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 4,4-dimethyl-3-(2,2,2-trifluoroethylamino)thiane-3-carboxamide |
| SMILES | CC1(C)CCSCC1(NCC(F)(F)F)C(N)=O |
| InChI | InChI=1S/C10H17F3N2OS/c1-8(2)3-4-17-6-9(8,7(14)16)15-5-10(11,12)13/h15H,3-6H2,1-2H3,(H2,14,16) |
| InChIKey | RNPXPGUWDCUZKS-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |