About 3-(butan-2-ylamino)-4,4-dimethylthiane-3-carbonitrile
3-(butan-2-ylamino)-4,4-dimethylthiane-3-carbonitrile (PubChem CID 79948745) has the molecular formula C12H22N2S
and a molecular weight of 226.39 g/mol. Its IUPAC name is 3-(butan-2-ylamino)-4,4-dimethylthiane-3-carbonitrile.
Molecular Properties
| Compound Name | 3-(butan-2-ylamino)-4,4-dimethylthiane-3-carbonitrile |
| PubChem CID | 79948745 |
| Molecular Formula | C12H22N2S |
| Molecular Weight | 226.39 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | 3-(butan-2-ylamino)-4,4-dimethylthiane-3-carbonitrile |
| SMILES | CCC(C)NC1(C#N)CSCCC1(C)C |
| InChI | InChI=1S/C12H22N2S/c1-5-10(2)14-12(8-13)9-15-7-6-11(12,3)4/h10,14H,5-7,9H2,1-4H3 |
| InChIKey | GJJOVKCJCBQKHX-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.39 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(butan-2-ylamino)-4,4-dimethylthiane-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(butan-2-ylamino)-4,4-dimethylthiane-3-carbonitrile?
The IUPAC name of 3-(butan-2-ylamino)-4,4-dimethylthiane-3-carbonitrile (CID 79948745) is 3-(butan-2-ylamino)-4,4-dimethylthiane-3-carbonitrile.
What is the SMILES notation for 3-(butan-2-ylamino)-4,4-dimethylthiane-3-carbonitrile?
The canonical SMILES for 3-(butan-2-ylamino)-4,4-dimethylthiane-3-carbonitrile is CCC(C)NC1(C#N)CSCCC1(C)C.
What is the InChIKey of 3-(butan-2-ylamino)-4,4-dimethylthiane-3-carbonitrile?
The InChIKey is GJJOVKCJCBQKHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2S/c1-5-10(2)14-12(8-13)9-15-7-6-11(12,3)4/h10,14H,5-7,9H2,1-4H3.
What are the key properties of 3-(butan-2-ylamino)-4,4-dimethylthiane-3-carbonitrile?
3-(butan-2-ylamino)-4,4-dimethylthiane-3-carbonitrile has a molecular weight of 226.39 g/mol, XLogP of 2.80, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(butan-2-ylamino)-4,4-dimethylthiane-3-carbonitrile is sourced from PubChem (CID 79948745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).