About 3-(butan-2-ylamino)-4,4-dimethylthiane-3-carboxamide
3-(butan-2-ylamino)-4,4-dimethylthiane-3-carboxamide (PubChem CID 79948828) has the molecular formula C12H24N2OS
and a molecular weight of 244.40 g/mol. Its IUPAC name is 3-(butan-2-ylamino)-4,4-dimethylthiane-3-carboxamide.
Molecular Properties
| Compound Name | 3-(butan-2-ylamino)-4,4-dimethylthiane-3-carboxamide |
| PubChem CID | 79948828 |
| Molecular Formula | C12H24N2OS |
| Molecular Weight | 244.40 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | 3-(butan-2-ylamino)-4,4-dimethylthiane-3-carboxamide |
| SMILES | CCC(C)NC1(C(N)=O)CSCCC1(C)C |
| InChI | InChI=1S/C12H24N2OS/c1-5-9(2)14-12(10(13)15)8-16-7-6-11(12,3)4/h9,14H,5-8H2,1-4H3,(H2,13,15) |
| InChIKey | ZHRWQQSNRCKQMW-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.40 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(butan-2-ylamino)-4,4-dimethylthiane-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(butan-2-ylamino)-4,4-dimethylthiane-3-carboxamide?
The IUPAC name of 3-(butan-2-ylamino)-4,4-dimethylthiane-3-carboxamide (CID 79948828) is 3-(butan-2-ylamino)-4,4-dimethylthiane-3-carboxamide.
What is the SMILES notation for 3-(butan-2-ylamino)-4,4-dimethylthiane-3-carboxamide?
The canonical SMILES for 3-(butan-2-ylamino)-4,4-dimethylthiane-3-carboxamide is CCC(C)NC1(C(N)=O)CSCCC1(C)C.
What is the InChIKey of 3-(butan-2-ylamino)-4,4-dimethylthiane-3-carboxamide?
The InChIKey is ZHRWQQSNRCKQMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2OS/c1-5-9(2)14-12(10(13)15)8-16-7-6-11(12,3)4/h9,14H,5-8H2,1-4H3,(H2,13,15).
What are the key properties of 3-(butan-2-ylamino)-4,4-dimethylthiane-3-carboxamide?
3-(butan-2-ylamino)-4,4-dimethylthiane-3-carboxamide has a molecular weight of 244.40 g/mol, XLogP of 1.76, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(butan-2-ylamino)-4,4-dimethylthiane-3-carboxamide is sourced from PubChem (CID 79948828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).