About 1-[[(4,4-dimethylthian-3-yl)amino]methyl]cyclopentan-1-ol
1-[[(4,4-dimethylthian-3-yl)amino]methyl]cyclopentan-1-ol (PubChem CID 79949058) has the molecular formula C13H25NOS
and a molecular weight of 243.42 g/mol. Its IUPAC name is 1-[[(4,4-dimethylthian-3-yl)amino]methyl]cyclopentan-1-ol.
Molecular Properties
| Compound Name | 1-[[(4,4-dimethylthian-3-yl)amino]methyl]cyclopentan-1-ol |
| PubChem CID | 79949058 |
| Molecular Formula | C13H25NOS |
| Molecular Weight | 243.42 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | 1-[[(4,4-dimethylthian-3-yl)amino]methyl]cyclopentan-1-ol |
| SMILES | CC1(C)CCSCC1NCC1(O)CCCC1 |
| InChI | InChI=1S/C13H25NOS/c1-12(2)7-8-16-9-11(12)14-10-13(15)5-3-4-6-13/h11,14-15H,3-10H2,1-2H3 |
| InChIKey | MZNHRJOVILCOST-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.42 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[[(4,4-dimethylthian-3-yl)amino]methyl]cyclopentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[(4,4-dimethylthian-3-yl)amino]methyl]cyclopentan-1-ol?
The IUPAC name of 1-[[(4,4-dimethylthian-3-yl)amino]methyl]cyclopentan-1-ol (CID 79949058) is 1-[[(4,4-dimethylthian-3-yl)amino]methyl]cyclopentan-1-ol.
What is the SMILES notation for 1-[[(4,4-dimethylthian-3-yl)amino]methyl]cyclopentan-1-ol?
The canonical SMILES for 1-[[(4,4-dimethylthian-3-yl)amino]methyl]cyclopentan-1-ol is CC1(C)CCSCC1NCC1(O)CCCC1.
What is the InChIKey of 1-[[(4,4-dimethylthian-3-yl)amino]methyl]cyclopentan-1-ol?
The InChIKey is MZNHRJOVILCOST-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NOS/c1-12(2)7-8-16-9-11(12)14-10-13(15)5-3-4-6-13/h11,14-15H,3-10H2,1-2H3.
What are the key properties of 1-[[(4,4-dimethylthian-3-yl)amino]methyl]cyclopentan-1-ol?
1-[[(4,4-dimethylthian-3-yl)amino]methyl]cyclopentan-1-ol has a molecular weight of 243.42 g/mol, XLogP of 2.41, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[(4,4-dimethylthian-3-yl)amino]methyl]cyclopentan-1-ol is sourced from PubChem (CID 79949058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).