About N-cyclohex-3-en-1-yl-4,4-dimethylthian-3-amine
N-cyclohex-3-en-1-yl-4,4-dimethylthian-3-amine (PubChem CID 79949061) has the molecular formula C13H23NS
and a molecular weight of 225.40 g/mol. Its IUPAC name is N-cyclohex-3-en-1-yl-4,4-dimethylthian-3-amine.
Molecular Properties
| Compound Name | N-cyclohex-3-en-1-yl-4,4-dimethylthian-3-amine |
| PubChem CID | 79949061 |
| Molecular Formula | C13H23NS |
| Molecular Weight | 225.40 g/mol |
| Exact Mass | 225.16 |
| IUPAC Name | N-cyclohex-3-en-1-yl-4,4-dimethylthian-3-amine |
| SMILES | CC1(C)CCSCC1NC1CC=CCC1 |
| InChI | InChI=1S/C13H23NS/c1-13(2)8-9-15-10-12(13)14-11-6-4-3-5-7-11/h3-4,11-12,14H,5-10H2,1-2H3 |
| InChIKey | GJCOPRSEQQFDHB-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.40 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-cyclohex-3-en-1-yl-4,4-dimethylthian-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohex-3-en-1-yl-4,4-dimethylthian-3-amine?
The IUPAC name of N-cyclohex-3-en-1-yl-4,4-dimethylthian-3-amine (CID 79949061) is N-cyclohex-3-en-1-yl-4,4-dimethylthian-3-amine.
What is the SMILES notation for N-cyclohex-3-en-1-yl-4,4-dimethylthian-3-amine?
The canonical SMILES for N-cyclohex-3-en-1-yl-4,4-dimethylthian-3-amine is CC1(C)CCSCC1NC1CC=CCC1.
What is the InChIKey of N-cyclohex-3-en-1-yl-4,4-dimethylthian-3-amine?
The InChIKey is GJCOPRSEQQFDHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23NS/c1-13(2)8-9-15-10-12(13)14-11-6-4-3-5-7-11/h3-4,11-12,14H,5-10H2,1-2H3.
What are the key properties of N-cyclohex-3-en-1-yl-4,4-dimethylthian-3-amine?
N-cyclohex-3-en-1-yl-4,4-dimethylthian-3-amine has a molecular weight of 225.40 g/mol, XLogP of 3.22, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohex-3-en-1-yl-4,4-dimethylthian-3-amine is sourced from PubChem (CID 79949061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).