C13H16ClNO2S — CID 79949297
methyl 3-(4-chloroanilino)-5-methylthiolane-3-carboxylate (PubChem CID 79949297) has the molecular formula C13H16ClNO2S and a molecular weight of 285.80 g/mol. Its IUPAC name is methyl 3-(4-chloroanilino)-5-methylthiolane-3-carboxylate.
| Compound Name | methyl 3-(4-chloroanilino)-5-methylthiolane-3-carboxylate |
|---|---|
| PubChem CID | 79949297 |
| Molecular Formula | C13H16ClNO2S |
| Molecular Weight | 285.80 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | methyl 3-(4-chloroanilino)-5-methylthiolane-3-carboxylate |
| SMILES | COC(=O)C1(Nc2ccc(Cl)cc2)CSC(C)C1 |
| InChI | InChI=1S/C13H16ClNO2S/c1-9-7-13(8-18-9,12(16)17-2)15-11-5-3-10(14)4-6-11/h3-6,9,15H,7-8H2,1-2H3 |
| InChIKey | MZDPDNPDBUIRRS-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.80 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |