About methyl 5-methyl-3-(2,2,2-trifluoroethylamino)thiolane-3-carboxylate
methyl 5-methyl-3-(2,2,2-trifluoroethylamino)thiolane-3-carboxylate (PubChem CID 79949298) has the molecular formula C9H14F3NO2S
and a molecular weight of 257.28 g/mol. Its IUPAC name is methyl 5-methyl-3-(2,2,2-trifluoroethylamino)thiolane-3-carboxylate.
Molecular Properties
| Compound Name | methyl 5-methyl-3-(2,2,2-trifluoroethylamino)thiolane-3-carboxylate |
| PubChem CID | 79949298 |
| Molecular Formula | C9H14F3NO2S |
| Molecular Weight | 257.28 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | methyl 5-methyl-3-(2,2,2-trifluoroethylamino)thiolane-3-carboxylate |
| SMILES | COC(=O)C1(NCC(F)(F)F)CSC(C)C1 |
| InChI | InChI=1S/C9H14F3NO2S/c1-6-3-8(5-16-6,7(14)15-2)13-4-9(10,11)12/h6,13H,3-5H2,1-2H3 |
| InChIKey | XMMQBJQNRGJXOS-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.28 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 5-methyl-3-(2,2,2-trifluoroethylamino)thiolane-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-methyl-3-(2,2,2-trifluoroethylamino)thiolane-3-carboxylate?
The IUPAC name of methyl 5-methyl-3-(2,2,2-trifluoroethylamino)thiolane-3-carboxylate (CID 79949298) is methyl 5-methyl-3-(2,2,2-trifluoroethylamino)thiolane-3-carboxylate.
What is the SMILES notation for methyl 5-methyl-3-(2,2,2-trifluoroethylamino)thiolane-3-carboxylate?
The canonical SMILES for methyl 5-methyl-3-(2,2,2-trifluoroethylamino)thiolane-3-carboxylate is COC(=O)C1(NCC(F)(F)F)CSC(C)C1.
What is the InChIKey of methyl 5-methyl-3-(2,2,2-trifluoroethylamino)thiolane-3-carboxylate?
The InChIKey is XMMQBJQNRGJXOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14F3NO2S/c1-6-3-8(5-16-6,7(14)15-2)13-4-9(10,11)12/h6,13H,3-5H2,1-2H3.
What are the key properties of methyl 5-methyl-3-(2,2,2-trifluoroethylamino)thiolane-3-carboxylate?
methyl 5-methyl-3-(2,2,2-trifluoroethylamino)thiolane-3-carboxylate has a molecular weight of 257.28 g/mol, XLogP of 1.58, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-methyl-3-(2,2,2-trifluoroethylamino)thiolane-3-carboxylate is sourced from PubChem (CID 79949298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).