C14H30N2OS — CID 79949986
3-(aminomethyl)-N-(2-methoxyethyl)-5-methyl-N-pentan-3-ylthiolan-3-amine (PubChem CID 79949986) has the molecular formula C14H30N2OS and a molecular weight of 274.47 g/mol. Its IUPAC name is 3-(aminomethyl)-N-(2-methoxyethyl)-5-methyl-N-pentan-3-ylthiolan-3-amine.
| Compound Name | 3-(aminomethyl)-N-(2-methoxyethyl)-5-methyl-N-pentan-3-ylthiolan-3-amine |
|---|---|
| PubChem CID | 79949986 |
| Molecular Formula | C14H30N2OS |
| Molecular Weight | 274.47 g/mol |
| Exact Mass | 274.21 |
| IUPAC Name | 3-(aminomethyl)-N-(2-methoxyethyl)-5-methyl-N-pentan-3-ylthiolan-3-amine |
| SMILES | CCC(CC)N(CCOC)C1(CN)CSC(C)C1 |
| InChI | InChI=1S/C14H30N2OS/c1-5-13(6-2)16(7-8-17-4)14(10-15)9-12(3)18-11-14/h12-13H,5-11,15H2,1-4H3 |
| InChIKey | FAEDVIWXYSBWMF-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.47 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |