About [5-methyl-3-(2,2,2-trifluoroethylamino)thiolan-3-yl]methanol
[5-methyl-3-(2,2,2-trifluoroethylamino)thiolan-3-yl]methanol (PubChem CID 79950653) has the molecular formula C8H14F3NOS
and a molecular weight of 229.27 g/mol. Its IUPAC name is [5-methyl-3-(2,2,2-trifluoroethylamino)thiolan-3-yl]methanol.
Molecular Properties
| Compound Name | [5-methyl-3-(2,2,2-trifluoroethylamino)thiolan-3-yl]methanol |
| PubChem CID | 79950653 |
| Molecular Formula | C8H14F3NOS |
| Molecular Weight | 229.27 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | [5-methyl-3-(2,2,2-trifluoroethylamino)thiolan-3-yl]methanol |
| SMILES | CC1CC(CO)(NCC(F)(F)F)CS1 |
| InChI | InChI=1S/C8H14F3NOS/c1-6-2-7(4-13,5-14-6)12-3-8(9,10)11/h6,12-13H,2-5H2,1H3 |
| InChIKey | CAMFCIZFUYOXBE-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.27 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [5-methyl-3-(2,2,2-trifluoroethylamino)thiolan-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-methyl-3-(2,2,2-trifluoroethylamino)thiolan-3-yl]methanol?
The IUPAC name of [5-methyl-3-(2,2,2-trifluoroethylamino)thiolan-3-yl]methanol (CID 79950653) is [5-methyl-3-(2,2,2-trifluoroethylamino)thiolan-3-yl]methanol.
What is the SMILES notation for [5-methyl-3-(2,2,2-trifluoroethylamino)thiolan-3-yl]methanol?
The canonical SMILES for [5-methyl-3-(2,2,2-trifluoroethylamino)thiolan-3-yl]methanol is CC1CC(CO)(NCC(F)(F)F)CS1.
What is the InChIKey of [5-methyl-3-(2,2,2-trifluoroethylamino)thiolan-3-yl]methanol?
The InChIKey is CAMFCIZFUYOXBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14F3NOS/c1-6-2-7(4-13,5-14-6)12-3-8(9,10)11/h6,12-13H,2-5H2,1H3.
What are the key properties of [5-methyl-3-(2,2,2-trifluoroethylamino)thiolan-3-yl]methanol?
[5-methyl-3-(2,2,2-trifluoroethylamino)thiolan-3-yl]methanol has a molecular weight of 229.27 g/mol, XLogP of 1.39, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [5-methyl-3-(2,2,2-trifluoroethylamino)thiolan-3-yl]methanol is sourced from PubChem (CID 79950653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).