About 5-methyl-3-(2,2,2-trifluoroethylamino)thiolane-3-carbonitrile
5-methyl-3-(2,2,2-trifluoroethylamino)thiolane-3-carbonitrile (PubChem CID 79950718) has the molecular formula C8H11F3N2S
and a molecular weight of 224.25 g/mol. Its IUPAC name is 5-methyl-3-(2,2,2-trifluoroethylamino)thiolane-3-carbonitrile.
Molecular Properties
| Compound Name | 5-methyl-3-(2,2,2-trifluoroethylamino)thiolane-3-carbonitrile |
| PubChem CID | 79950718 |
| Molecular Formula | C8H11F3N2S |
| Molecular Weight | 224.25 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 5-methyl-3-(2,2,2-trifluoroethylamino)thiolane-3-carbonitrile |
| SMILES | CC1CC(C#N)(NCC(F)(F)F)CS1 |
| InChI | InChI=1S/C8H11F3N2S/c1-6-2-7(3-12,5-14-6)13-4-8(9,10)11/h6,13H,2,4-5H2,1H3 |
| InChIKey | RCRSDJGQOBDJOK-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.25 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methyl-3-(2,2,2-trifluoroethylamino)thiolane-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-3-(2,2,2-trifluoroethylamino)thiolane-3-carbonitrile?
The IUPAC name of 5-methyl-3-(2,2,2-trifluoroethylamino)thiolane-3-carbonitrile (CID 79950718) is 5-methyl-3-(2,2,2-trifluoroethylamino)thiolane-3-carbonitrile.
What is the SMILES notation for 5-methyl-3-(2,2,2-trifluoroethylamino)thiolane-3-carbonitrile?
The canonical SMILES for 5-methyl-3-(2,2,2-trifluoroethylamino)thiolane-3-carbonitrile is CC1CC(C#N)(NCC(F)(F)F)CS1.
What is the InChIKey of 5-methyl-3-(2,2,2-trifluoroethylamino)thiolane-3-carbonitrile?
The InChIKey is RCRSDJGQOBDJOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11F3N2S/c1-6-2-7(3-12,5-14-6)13-4-8(9,10)11/h6,13H,2,4-5H2,1H3.
What are the key properties of 5-methyl-3-(2,2,2-trifluoroethylamino)thiolane-3-carbonitrile?
5-methyl-3-(2,2,2-trifluoroethylamino)thiolane-3-carbonitrile has a molecular weight of 224.25 g/mol, XLogP of 1.93, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-3-(2,2,2-trifluoroethylamino)thiolane-3-carbonitrile is sourced from PubChem (CID 79950718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).