C14H24N2OS2 — CID 79950737
3-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-N-(2-methoxyethyl)-5-methylthiolan-3-amine (PubChem CID 79950737) has the molecular formula C14H24N2OS2 and a molecular weight of 300.49 g/mol. Its IUPAC name is 3-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-N-(2-methoxyethyl)-5-methylthiolan-3-amine.
| Compound Name | 3-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-N-(2-methoxyethyl)-5-methylthiolan-3-amine |
|---|---|
| PubChem CID | 79950737 |
| Molecular Formula | C14H24N2OS2 |
| Molecular Weight | 300.49 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 3-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-N-(2-methoxyethyl)-5-methylthiolan-3-amine |
| SMILES | CCc1nc(C2(NCCOC)CSC(C)C2)sc1C |
| InChI | InChI=1S/C14H24N2OS2/c1-5-12-11(3)19-13(16-12)14(15-6-7-17-4)8-10(2)18-9-14/h10,15H,5-9H2,1-4H3 |
| InChIKey | YHICLTHPUXRVQF-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.49 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|