About ethyl 2-methyl-3-(2,2,2-trifluoroethylamino)thiane-3-carboxylate
ethyl 2-methyl-3-(2,2,2-trifluoroethylamino)thiane-3-carboxylate (PubChem CID 79951045) has the molecular formula C11H18F3NO2S
and a molecular weight of 285.33 g/mol. Its IUPAC name is ethyl 2-methyl-3-(2,2,2-trifluoroethylamino)thiane-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-methyl-3-(2,2,2-trifluoroethylamino)thiane-3-carboxylate |
| PubChem CID | 79951045 |
| Molecular Formula | C11H18F3NO2S |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | ethyl 2-methyl-3-(2,2,2-trifluoroethylamino)thiane-3-carboxylate |
| SMILES | CCOC(=O)C1(NCC(F)(F)F)CCCSC1C |
| InChI | InChI=1S/C11H18F3NO2S/c1-3-17-9(16)10(15-7-11(12,13)14)5-4-6-18-8(10)2/h8,15H,3-7H2,1-2H3 |
| InChIKey | YYVTZHGFCAFXMG-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 2-methyl-3-(2,2,2-trifluoroethylamino)thiane-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-methyl-3-(2,2,2-trifluoroethylamino)thiane-3-carboxylate?
The IUPAC name of ethyl 2-methyl-3-(2,2,2-trifluoroethylamino)thiane-3-carboxylate (CID 79951045) is ethyl 2-methyl-3-(2,2,2-trifluoroethylamino)thiane-3-carboxylate.
What is the SMILES notation for ethyl 2-methyl-3-(2,2,2-trifluoroethylamino)thiane-3-carboxylate?
The canonical SMILES for ethyl 2-methyl-3-(2,2,2-trifluoroethylamino)thiane-3-carboxylate is CCOC(=O)C1(NCC(F)(F)F)CCCSC1C.
What is the InChIKey of ethyl 2-methyl-3-(2,2,2-trifluoroethylamino)thiane-3-carboxylate?
The InChIKey is YYVTZHGFCAFXMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18F3NO2S/c1-3-17-9(16)10(15-7-11(12,13)14)5-4-6-18-8(10)2/h8,15H,3-7H2,1-2H3.
What are the key properties of ethyl 2-methyl-3-(2,2,2-trifluoroethylamino)thiane-3-carboxylate?
ethyl 2-methyl-3-(2,2,2-trifluoroethylamino)thiane-3-carboxylate has a molecular weight of 285.33 g/mol, XLogP of 2.36, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-methyl-3-(2,2,2-trifluoroethylamino)thiane-3-carboxylate is sourced from PubChem (CID 79951045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).