C13H16Cl3NS — CID 79951111
4,4-dimethyl-N-(2,4,6-trichlorophenyl)thian-3-amine (PubChem CID 79951111) has the molecular formula C13H16Cl3NS and a molecular weight of 324.70 g/mol. Its IUPAC name is 4,4-dimethyl-N-(2,4,6-trichlorophenyl)thian-3-amine.
| Compound Name | 4,4-dimethyl-N-(2,4,6-trichlorophenyl)thian-3-amine |
|---|---|
| PubChem CID | 79951111 |
| Molecular Formula | C13H16Cl3NS |
| Molecular Weight | 324.70 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | 4,4-dimethyl-N-(2,4,6-trichlorophenyl)thian-3-amine |
| SMILES | CC1(C)CCSCC1Nc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C13H16Cl3NS/c1-13(2)3-4-18-7-11(13)17-12-9(15)5-8(14)6-10(12)16/h5-6,11,17H,3-4,7H2,1-2H3 |
| InChIKey | ZLNOWSBTOLWYNR-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.70 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |