About 6,6-dimethyl-2-oxa-9-thiaspiro[4.5]decane-1,3-dione
6,6-dimethyl-2-oxa-9-thiaspiro[4.5]decane-1,3-dione (PubChem CID 79951514) has the molecular formula C10H14O3S
and a molecular weight of 214.29 g/mol. Its IUPAC name is 6,6-dimethyl-2-oxa-9-thiaspiro[4.5]decane-1,3-dione.
Molecular Properties
| Compound Name | 6,6-dimethyl-2-oxa-9-thiaspiro[4.5]decane-1,3-dione |
| PubChem CID | 79951514 |
| Molecular Formula | C10H14O3S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | 6,6-dimethyl-2-oxa-9-thiaspiro[4.5]decane-1,3-dione |
| SMILES | CC1(C)CCSCC12CC(=O)OC2=O |
| InChI | InChI=1S/C10H14O3S/c1-9(2)3-4-14-6-10(9)5-7(11)13-8(10)12/h3-6H2,1-2H3 |
| InChIKey | PHIMAJRCQSXIBP-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 6,6-dimethyl-2-oxa-9-thiaspiro[4.5]decane-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-dimethyl-2-oxa-9-thiaspiro[4.5]decane-1,3-dione?
The IUPAC name of 6,6-dimethyl-2-oxa-9-thiaspiro[4.5]decane-1,3-dione (CID 79951514) is 6,6-dimethyl-2-oxa-9-thiaspiro[4.5]decane-1,3-dione.
What is the SMILES notation for 6,6-dimethyl-2-oxa-9-thiaspiro[4.5]decane-1,3-dione?
The canonical SMILES for 6,6-dimethyl-2-oxa-9-thiaspiro[4.5]decane-1,3-dione is CC1(C)CCSCC12CC(=O)OC2=O.
What is the InChIKey of 6,6-dimethyl-2-oxa-9-thiaspiro[4.5]decane-1,3-dione?
The InChIKey is PHIMAJRCQSXIBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O3S/c1-9(2)3-4-14-6-10(9)5-7(11)13-8(10)12/h3-6H2,1-2H3.
What are the key properties of 6,6-dimethyl-2-oxa-9-thiaspiro[4.5]decane-1,3-dione?
6,6-dimethyl-2-oxa-9-thiaspiro[4.5]decane-1,3-dione has a molecular weight of 214.29 g/mol, XLogP of 1.61, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-dimethyl-2-oxa-9-thiaspiro[4.5]decane-1,3-dione is sourced from PubChem (CID 79951514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).