About 2-methyl-3-(2,2,2-trifluoroethylamino)thiane-3-carbonitrile
2-methyl-3-(2,2,2-trifluoroethylamino)thiane-3-carbonitrile (PubChem CID 79952041) has the molecular formula C9H13F3N2S
and a molecular weight of 238.28 g/mol. Its IUPAC name is 2-methyl-3-(2,2,2-trifluoroethylamino)thiane-3-carbonitrile.
Molecular Properties
| Compound Name | 2-methyl-3-(2,2,2-trifluoroethylamino)thiane-3-carbonitrile |
| PubChem CID | 79952041 |
| Molecular Formula | C9H13F3N2S |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 2-methyl-3-(2,2,2-trifluoroethylamino)thiane-3-carbonitrile |
| SMILES | CC1SCCCC1(C#N)NCC(F)(F)F |
| InChI | InChI=1S/C9H13F3N2S/c1-7-8(5-13,3-2-4-15-7)14-6-9(10,11)12/h7,14H,2-4,6H2,1H3 |
| InChIKey | MZCFQHPYLSWSFY-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-3-(2,2,2-trifluoroethylamino)thiane-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3-(2,2,2-trifluoroethylamino)thiane-3-carbonitrile?
The IUPAC name of 2-methyl-3-(2,2,2-trifluoroethylamino)thiane-3-carbonitrile (CID 79952041) is 2-methyl-3-(2,2,2-trifluoroethylamino)thiane-3-carbonitrile.
What is the SMILES notation for 2-methyl-3-(2,2,2-trifluoroethylamino)thiane-3-carbonitrile?
The canonical SMILES for 2-methyl-3-(2,2,2-trifluoroethylamino)thiane-3-carbonitrile is CC1SCCCC1(C#N)NCC(F)(F)F.
What is the InChIKey of 2-methyl-3-(2,2,2-trifluoroethylamino)thiane-3-carbonitrile?
The InChIKey is MZCFQHPYLSWSFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13F3N2S/c1-7-8(5-13,3-2-4-15-7)14-6-9(10,11)12/h7,14H,2-4,6H2,1H3.
What are the key properties of 2-methyl-3-(2,2,2-trifluoroethylamino)thiane-3-carbonitrile?
2-methyl-3-(2,2,2-trifluoroethylamino)thiane-3-carbonitrile has a molecular weight of 238.28 g/mol, XLogP of 2.32, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3-(2,2,2-trifluoroethylamino)thiane-3-carbonitrile is sourced from PubChem (CID 79952041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).